On Target OPRX_HUMAN 0.2581967/CHEMBL3262362
For the given ligand yong1, we have found in our database that, being scored 0.2581967, the most similar ligand is CHEMBL3262362. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3262362 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC[C@](O)([C@H]1C[C@]23C=C[C@]1(OC)[C@@H]4Oc5c(O)ccc6C[C@H]2N(CC7CC7)CC[C@@]34c56)C(C)(C)C |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04001000 cb000208 20100d0a 80310700 00381061 c2000802 02081000 38000643 00002890 011818ca 48300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 17492012 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f50 |