On Target HRH1_HUMAN 0.21764706/CHEMBL1101
For the given ligand yong1, we have found in our database that, being scored 0.21764706, the most similar ligand is CHEMBL1101. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1101 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | OC(CCN1CCCCC1)(C2CC3CC2C=C3)c4ccccc4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00000000 81000200 00100102 00010600 00080000 00004000 00000000 20000402 00000900 001808c8 08300000 50018000 00020002 00a00000 00000400 000c0008 00000000 02000020 00c02000 00002201 00000100 18000030 01008080 00500010 00200001 80202000 00404000 90000000 00000002 0106000a 64020000 00002600 |