On Target 5HT4R_HUMAN 0.21576764/CHEMBL1632169
For the given ligand yong1, we have found in our database that, being scored 0.21576764, the most similar ligand is CHEMBL1632169. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1632169 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC(C)(C)C(=O)OCOC(=O)CCCCCN1CCC(CNC(=O)c2c3OCCCn3c4ccccc24)CC1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 14010002 01801818 60100108 00010f10 800c1030 02020100 06084800 2a003404 00210200 009008e0 09240004 50039020 0480980e 00c00000 21020541 023c200c 10a20008 a2808000 40e0a000 00060201 c0020040 18078e18 21800000 8050001c 00044000 c0000000 48000a00 b4000000 01000300 00060001 a42c8200 84002260 |