On Target CCR2_HUMAN 0.28846154/CHEMBL3753178
For the given ligand yong1, we have found in our database that, being scored 0.28846154, the most similar ligand is CHEMBL3753178. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3753178 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2cc(C)cc(C)c2 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00010000 01000000 00000102 00010200 00080001 00800000 00000081 08000402 01000800 00980840 08100000 40009000 04028028 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a80 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |