On Target CXCR2_HUMAN 0.1919192/CHEMBL3645131
For the given ligand yong1, we have found in our database that, being scored 0.1919192, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |