On Target MC5R_HUMAN 0.17167382/CHEMBL380635
For the given ligand yong1, we have found in our database that, being scored 0.17167382, the most similar ligand is CHEMBL380635. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL380635 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | Clc1ccc(C[C@@H](NC(=O)[C@H]2Cc3ccccc3CN2)C(=O)N4CCC(CN5C(=O)OCC56CCC6)(CC4)C7CCCCC7)cc1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00008008 01407200 00100300 14010700 000800a0 00008000 01000000 a200100c 00200a80 000908c0 08300000 5003b800 06008826 00202111 80081400 021e0008 10860000 02080020 02402808 00000201 00020100 38248f50 13004003 83500018 00002800 c0001003 10044000 90200001 0c000300 0086000b a0064000 00022600 |