On Target EDNRA_HUMAN 0.3195266/CHEMBL323951
For the given ligand test1, we have found in our database that, being scored 0.3195266, the most similar ligand is CHEMBL323951. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL323951 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCCN(CCCC)C(=O)CN1C[C@@H]([C@H]([C@@H]1CC(C)(C)\C=C/C)C(=O)O)c2ccc3OCOc3c2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030000 43001208 2010010a 04010600 00181000 c0000010 02040000 20000400 10200880 001808c0 48300000 4001b000 0e02c00a 20a02000 81000401 002c8008 00004000 02000000 00c82018 00020201 00040300 38240e10 010080c1 83500018 40001801 80000000 00524000 b0000000 0d000202 0006000b 24024000 00812e00 |