On Target NPY2R_HUMAN 0.390625/CHEMBL4089420
For the given ligand test1, we have found in our database that, being scored 0.390625, the most similar ligand is CHEMBL4089420. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL4089420 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCC(NC(=O)[C@H](CCCNC(=N)N)NC(=O)C(C)C)C(=O)NC(CC1CCCCC1)C(=O)NC(CC2CCCCC2)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NC(CC3CCCCC3)C(=O)N |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030000 01007400 00100000 04000c00 00000080 00000000 00000000 20002008 00200200 00020182 00200000 40033000 1e00901a 00002001 80180000 00180008 10000000 00000001 02802010 00000201 00000000 300d0630 03000083 02100018 00001001 00000000 40000000 10000000 08000012 00040011 a00a4000 00802200 |