On Target ADRB2_HUMAN 0.342723/CHEMBL1714856
For the given ligand test1, we have found in our database that, being scored 0.342723, the most similar ligand is CHEMBL1714856. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1714856 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | COC(=O)C1=C(C[C@@H]2CC[C@H]1N2C(=O)NCc3cccc(F)c3)c4cccc(OCc5ccccc5)c4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 04010010 4b809208 2010030a 02010f00 00081040 40004810 82180184 3a003402 01800900 015828c8 49300000 51119000 0c82990a 20a11080 01000423 020c0108 20a24400 02000541 40c9a05a 00820201 80000100 18158eb0 010080a0 00d01018 01213083 80002401 00486000 d0010501 00400302 0006850b 6c0e0000 82002710 |