On Target CCR4_HUMAN 0.34351146/CHEMBL1621896
For the given ligand test1, we have found in our database that, being scored 0.34351146, the most similar ligand is CHEMBL1621896. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1621896 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | COc1ccc(Br)cc1CN2CCCC(C2)C(=O)N3CCCCC3 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00014000 21009408 20100108 00010600 00001000 00000100 02000000 22001400 40000000 001009e0 08200000 d0019000 0c008812 00000000 01000501 00002008 00000000 02000000 00000010 00020201 00000000 18048620 00008000 00500018 00001000 c0000000 00420000 90000000 00000300 00060011 24040008 08002200 |