On Target GASR_HUMAN 0.34868422/CHEMBL433621
For the given ligand test1, we have found in our database that, being scored 0.34868422, the most similar ligand is CHEMBL433621. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL433621 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | OC(=O)C(CC(=O)NCc1ccccc1)NC(=O)CCC(NC(=O)c2cc(Cl)cc(Cl)c2)C(=O)N3CCC4(CCCC4)CC3 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00078000 09807c00 00100100 04010600 00100080 00000020 04000000 22001008 00200000 000309e8 00200000 5003b800 0e008816 00002400 80080400 00080008 10000000 02000001 00402010 00000201 80000000 380e8f30 03000001 0250001c 00003000 c0000000 00000000 90000000 08000102 01060811 a0064000 00822a00 |