On Target OPRM_HUMAN 0.4072165/CHEMBL362202
For the given ligand test1, we have found in our database that, being scored 0.4072165, the most similar ligand is CHEMBL362202. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL362202 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | COC1[C@H](NC(=O)CC2OC(CO)C(O)C(O)C2O)C=C[C@H]3[C@H]4Cc5ccc(O)cc5[C@@]13CCN4C |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00050050 cb00d208 20100d02 80110700 803c00e1 40200002 02180000 20000443 00000880 011818ca 08300200 51819000 1402812a 03a90000 000c1424 020e9308 38a00200 02000160 15c12000 0002a201 00000120 18240630 1700e080 89540018 00200401 80002001 00da4200 90000121 04000202 00060c0b 2c020000 02012e00 |