On Target HRH2_HUMAN 0.24060151/CHEMBL588119
For the given ligand test1, we have found in our database that, being scored 0.24060151, the most similar ligand is CHEMBL588119. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL588119 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCCCCCCN[C@H](C)[C@@H](O)c1ccc(SC(C)C)cc1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000000 01801200 00120100 00110600 00000080 00004000 00000000 20000000 00000980 000848c0 08700000 60018000 00000002 00050000 00080000 00080008 14000000 02000000 00002000 00000201 80000100 18340030 03800000 81500019 00000000 80000000 00000000 10000000 04000000 00060002 50020000 00012620 |