On Target CCR5_HUMAN 0.3939394/CHEMBL1172157
For the given ligand test1, we have found in our database that, being scored 0.3939394, the most similar ligand is CHEMBL1172157. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1172157 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O[C@@]1(CN(C[C@@H]1CN2CCC(CC2)N(CC=C)C(=O)Cc3ccccc3)C(=O)C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010000 01005600 00100100 00010600 00000080 00004010 00000000 20000404 00200980 000809e0 08300000 50039000 0500800a 00010000 40080000 000c0008 10000000 02000100 00802000 00000201 00000100 183c0630 03000080 81500018 00000001 80000000 00080000 10000000 04000000 0106001b 4c002000 02002600 |