On Target ADRB3_HUMAN 0.29139072/CHEMBL3746280
For the given ligand test1, we have found in our database that, being scored 0.29139072, the most similar ligand is CHEMBL3746280. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3746280 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC1(C)CC2(CCN(CC2)C(=O)c3ccc(C[C@@H]4CC[C@@H](N4)[C@H](O)c5ccccc5)cc3)C(=O)O1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00070000 01001800 00100102 40010700 00180080 00004010 00000000 22001000 00000980 000808c0 08300000 50019800 84008802 01a00000 00080400 00081008 10820000 02000000 00402000 00000201 00000120 18268e30 03000000 8150001c 00000400 c0000000 00000200 90000000 04000302 00060003 e0060000 00802e00 |