On Target CCR1_HUMAN 0.3888889/CHEMBL33277
For the given ligand test1, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL33277. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL33277 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O=C(NC1CCN(C\C\2=C\CCCCCC2)CC1)C3c4ccccc4Oc5ccccc35 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000010 01009408 20100108 00018600 00001000 00000000 02100000 29000602 00000084 001809e0 08200000 50019080 01028102 00010000 41000401 00002108 b0000000 02000100 00002000 00020201 00400000 18280610 00008000 87500018 00200000 e0000400 00484000 d0200000 04000380 00060013 26022400 02002600 |