On Target TAAR1_HUMAN 0.56565654/CHEMBL1429767
For the given ligand test1, we have found in our database that, being scored 0.56565654, the most similar ligand is CHEMBL1429767. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1429767 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | OC(=O)\C=C\C(=O)NCCC1=CCCCC1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000000 09009000 00100000 00000400 00000000 00000000 00180000 20000402 01000000 00100088 00200000 41010000 00028002 00010000 00000400 00080008 20000000 00000160 40212010 00000201 00000000 10040f10 00008000 00100018 00201000 08008800 00484000 90000000 00000000 00040401 04020000 02000200 |