On Target ADA1D_HUMAN 0.34013605/CHEMBL12127
For the given ligand test1, we have found in our database that, being scored 0.34013605, the most similar ligand is CHEMBL12127. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL12127 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(C)Oc1ccccc1N2CCN(C\C=C\C(=O)CN3CCCCC3=O)CC2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 04014012 09009008 20100028 04010600 80001000 00000000 02180000 20000400 01000000 00100ac8 00240004 5001b000 06808112 00012000 81000041 00084208 20040000 00000140 48010000 00021201 40100000 38040700 20408020 0210801a 00000000 08000000 20480000 10000080 08008200 00060401 24004800 00002200 |