On Target OPRK_HUMAN 0.38926175/CHEMBL144483
For the given ligand test1, we have found in our database that, being scored 0.38926175, the most similar ligand is CHEMBL144483. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL144483 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | COC(=O)C1=CCCN(CC2CCCCN2C(=O)Cc3ccc(Cl)c(Cl)c3)C1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00008010 0d00b000 00100100 04010600 00000000 00000800 04180100 30000408 01000080 001808c8 48200000 50019800 0b008126 00012000 c0000000 00080008 20220000 02000140 00812012 00001201 00000000 38240f90 01008081 83580018 00003001 80100400 004c0000 10000000 0c000200 00060403 04002000 02022610 |