On Target GRM7_HUMAN 0.15686275/CHEMBL432038
For the given ligand test1, we have found in our database that, being scored 0.15686275, the most similar ligand is CHEMBL432038. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL432038 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | N[C@@](CC1c2ccccc2Oc3ccccc13)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030000 01000208 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a00 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 0006c00a 02020400 00400400 |