On Target AA1R_HUMAN 0.2972973/CHEMBL329774
For the given ligand test1, we have found in our database that, being scored 0.2972973, the most similar ligand is CHEMBL329774. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL329774 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCN1C(=O)C2NC(NC2N(CCCOC(=O)CBr)C1=O)C3CCCC3 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010000 0300b400 00100100 04010e00 00000000 00000000 00000024 20002008 00000000 000201a0 06200002 4001b000 0f00b102 00082000 80000000 00080008 00220010 00802001 00802050 00000201 00020920 301b0e10 01000081 02100018 00013403 00000000 00000000 10000100 08000200 01040015 08184009 00002200 |