On Target MSHR_HUMAN 0.3057325/CHEMBL379879
For the given ligand test1, we have found in our database that, being scored 0.3057325, the most similar ligand is CHEMBL379879. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL379879 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | N[C@H](Cc1ccccc1)C(=O)N2C[C@@H](C[C@@H]2CCCN=C(N)N)OCc3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000000 01005200 00100100 80010f00 00080092 00004010 00010000 20000000 00200900 000808c2 08301010 4003b000 04008002 00890008 00181008 020c1008 10a00800 02000000 00c02008 00000201 00000120 38140638 13000081 83500018 00000c01 80002000 40890000 10000001 0c000200 0006000b 40020000 02002600 |