On Target PTAFR_HUMAN 0.30769232/CHEMBL300463
For the given ligand test1, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL300463. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL300463 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCCCC(=C\C=C\C(=O)N[C@H](C)CCCc1cccnc1)CCCCC |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000002 0104d000 00104102 00800610 40041100 00000001 00102000 20000400 01500800 001800c0 00340004 40010000 00028802 20210800 00000400 00040004 20000000 02000104 00292480 00000201 40000100 18048600 60808000 0050001a 00040000 00000000 08484000 90000000 00400002 000e0003 24020000 02000600 |