On Target 5HT1F_HUMAN 0.21714285/CHEMBL432713
For the given ligand test1, we have found in our database that, being scored 0.21714285, the most similar ligand is CHEMBL432713. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL432713 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | Oc1ccc2[nH]cc(C3CCN(CCCCCNC(=O)\C=C\c4ccc(Cl)c(Cl)c4)CC3)c2c1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00008002 01009a08 20100100 40810610 00041200 00000000 86102080 20000400 01c00800 004a08c0 08300004 50018800 0a008806 00410800 80000042 0004000c 20000400 02000100 00218400 00820201 40000100 18048728 20800000 80500018 00042000 80100000 085e2000 50010000 00400000 0006030b 04040200 02022620 |