On Target NPBW1_HUMAN 0.18932039/CHEMBL1989982
For the given ligand test1, we have found in our database that, being scored 0.18932039, the most similar ligand is CHEMBL1989982. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1989982 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | ClC1=C(C(C#N)C(=O)N2CCCC2)C(=O)N(Cc3cccc4ccccc34)N=C1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010004 52003608 20110180 01010618 000a0047 80188010 0004a000 20001010 06300080 800808c0 00202008 7001b900 1700982a 08e00000 80040000 000d280c 08400008 82004000 00200010 00220201 00000400 1c258718 41800c81 9370001c 04107000 80000600 00128000 10040000 04080000 000e000b 04042000 008222a0 |