On Target ADRB1_HUMAN 0.32608697/CHEMBL1085009
For the given ligand test1, we have found in our database that, being scored 0.32608697, the most similar ligand is CHEMBL1085009. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1085009 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | OC(COc1ccccc1CC=C)CN2CCC(CN3C(=O)CCCC3=O)CC2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 04010000 01001008 20100108 00010600 00001080 82800000 02000001 20000600 00240010 001a08c0 08200000 50039000 04808012 00000000 01280001 00082008 10200000 22108000 00800000 00020201 00020000 18040600 07000080 08500018 00200001 c0000000 00000000 10800000 00000300 00060003 04000000 00002640 |