On Target AGTR2_HUMAN 0.25465837/CHEMBL3350599
For the given ligand test1, we have found in our database that, being scored 0.25465837, the most similar ligand is CHEMBL3350599. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3350599 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC[C@H](C)[C@H](NC(=O)[C@H](N)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00070000 01007200 00100100 04010e00 00100082 00000010 00010000 2000200c 00200880 000808c2 08300010 4003b000 0e00b012 00002009 80180000 000c0008 10000810 02000000 00c00008 00000201 00000100 38250e20 03000043 83500018 00000800 80000000 40010000 10000000 0c000002 0006000b 20084000 00802e00 |