On Target AA2AR_HUMAN 0.3021978/CHEMBL2153614
For the given ligand test1, we have found in our database that, being scored 0.3021978, the most similar ligand is CHEMBL2153614. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2153614 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CN1C(=O)N(C)c2nc3N(CCC4=CCCCC4)CCCn3c2C1=O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 0001002e 09801c00 00380000 02010700 00080040 0000c040 0008a000 20100c02 06600110 a01001e8 0c20800c 41011000 04029002 01c42000 00280480 100c000c 00900000 0008c060 00402000 00a00201 80000100 5c000050 2180c841 00700014 40240000 c0208000 62404000 90040001 01004018 00461c10 c40a1000 80002288 |