On Target TSHR_HUMAN 0.32954547/CHEMBL3897841
For the given ligand test1, we have found in our database that, being scored 0.32954547, the most similar ligand is CHEMBL3897841. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3897841 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(=O)N1CCC(C)(C2C=C(NC(=O)OC3CCCC3)C=CC12)c4ccccc4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00400030 09449200 0a100102 00110700 480e0000 00300001 00180000 a0000414 00000e00 001808ca 08340040 54418220 00028102 00210100 00002400 001e010c 20830000 03000142 40412880 00000201 00008900 18040e10 41008000 0050021a 00000000 80003002 00484800 90240100 10000200 010e140b ac000000 42012600 |