On Target NPFF1_HUMAN 0.285/CHEMBL472833
For the given ligand test1, we have found in our database that, being scored 0.285, the most similar ligand is CHEMBL472833. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL472833 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(C)C[C@H](\C=C\CNC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(F)cc2)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00018012 0900ba00 01100100 47810e10 00041200 00000010 00182040 2200340c 00600ac0 001908ca 08300004 4003b000 1e029912 00413801 80200440 00140304 20000000 02000140 00200408 00101201 40000100 38278628 20808003 9350001c 00043800 c0000000 48484000 90000101 0c000110 0006840b ac0c4200 02002620 |