On Target CCKAR_HUMAN 0.2751678/CHEMBL206025
For the given ligand test1, we have found in our database that, being scored 0.2751678, the most similar ligand is CHEMBL206025. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL206025 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCCCN(CCCOC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00038000 09003800 00100100 04010600 00180000 00000000 04000000 22001008 00000000 000b08c8 00200000 4001b800 06008876 01002000 80000400 00080008 00200000 02000000 00c00000 00000201 00000000 38168f00 01000081 0250001c 00002001 c0100000 00040000 90000000 08000300 00060801 a0044000 00822a00 |