On Target GRM8_HUMAN 0.23239437/CHEMBL2418359
For the given ligand test1, we have found in our database that, being scored 0.23239437, the most similar ligand is CHEMBL2418359. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL2418359 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O=C(N1C[C@@H]2CN(C[C@@H]2C1)c3ccccn3)N4CCC5(CCCC5)C4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00004002 01001400 00104000 00000e00 20040000 00002010 00000004 20102000 00200000 200001e0 00200004 40030000 00009802 00000000 00020000 00040004 00040000 00004000 08202040 00a00201 60100100 1c0d8410 20800800 00300018 00010000 00000000 00000080 10000080 00008018 01060811 001a1000 00002200 |