On Target HRH4_HUMAN 0.2993197/CHEMBL4083336
For the given ligand test1, we have found in our database that, being scored 0.2993197, the most similar ligand is CHEMBL4083336. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL4083336 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O=C(CCNC(=O)C(Cc1ccccc1)Cn2ccnc2)OCc3ccccc3 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000002 00001600 00100100 00010600 000e0050 00104000 00000000 20000000 00300900 000809c0 08308008 40019000 0c009002 018d0000 00000080 020c000c 00320000 02000001 00c00018 00000201 80000120 18100e30 21000080 00400018 00001c01 80002000 00080000 10000000 00000200 0046001b 40080000 02002600 |