On Target BKRB2_HUMAN 0.31896552/CHEMBL109172
For the given ligand test1, we have found in our database that, being scored 0.31896552, the most similar ligand is CHEMBL109172. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL109172 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CN1CCC2(CC1)N(CC3CCCCC3)CN(CC(=O)C)C2=O |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030000 01001400 00100000 04000c00 00000000 00000000 00000004 20002000 00200000 000001a0 00200000 50033000 06009002 00002001 80000000 00000000 00000000 00002000 02002040 00000201 00000100 30010610 00000001 02100018 00010000 00000000 00000000 10000000 08000000 00040011 201a4000 00802200 |