On Target 5HT7R_HUMAN 0.37762237/CHEMBL239897
For the given ligand test1, we have found in our database that, being scored 0.37762237, the most similar ligand is CHEMBL239897. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL239897 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | FC(F)(F)c1cccc(c1)N2CCN(CCCCN3C(=O)C4=C(CCCC4)C3=O)CC2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00014012 01009000 40100120 04010600 00000000 08000000 00100480 20000402 01200000 00100ad0 00200004 40039004 0402810a 01012000 00000440 00000100 20040000 02000120 08212000 00000211 40120000 38040790 20008021 0250001a 00040000 88000000 00484000 90000180 08408000 00060001 0c120000 02002200 |