On Target 5HT4R_HUMAN 0.3144654/CHEMBL3759546
For the given ligand test1, we have found in our database that, being scored 0.3144654, the most similar ligand is CHEMBL3759546. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL3759546 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CCCC(=O)N1CCC(CN2CC[C@H](NC(=O)c3cc(Cl)c(N)cc3OC)[C@@H](C2)OC)CC1 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 0000800a 89005c08 20100108 80010700 00101080 00020100 06000000 22001400 00200000 001009e8 08200004 50039800 06008806 08000000 81081441 00082008 10000000 02000400 00400000 00020601 40000000 180e8700 33000000 0050001c 00002000 c0000400 00900a00 90000001 00000300 00060811 a4040000 00022a00 |