On Target CCR2_HUMAN 0.4217687/CHEMBL1683054
For the given ligand test1, we have found in our database that, being scored 0.4217687, the most similar ligand is CHEMBL1683054. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1683054 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC(C)[C@@]1(CC[C@H](C1)NC2CCOCC2)C(=O)N3CCC(=CC3)c4cccc(c4)C(F)(F)F |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00030010 09019200 00100100 00010700 80080001 00000000 80180480 20000400 00200800 005808d8 08300000 40039002 0400811a 01090000 00000002 000c0008 20200400 02000140 40c02002 00800201 00000120 18040630 01008080 00500018 00000401 80000000 00482000 d0010100 00404200 0126040b 8c120000 02802600 |