On Target GASR_HUMAN 0.07/CHEMBL30844
For the given ligand Asprin, we have found in our database that, being scored 0.07, the most similar ligand is CHEMBL30844. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL30844 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | OC(=O)CCCNC(=O)CCC(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)N2CCC3(CCCC3)CC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00038000 09003800 00100100 04010600 00100000 00000020 04000000 22001008 00200000 000308c8 00200000 5003b800 06008816 00002400 80000400 00080008 00000000 02000000 00402000 00000201 00000000 38068f30 01000001 0250001c 00002000 c0000000 00000000 90000000 08000100 01060801 a0064000 00822a00 |