On Target MC4R_HUMAN 0.10958904/CHEMBL1699592
For the given ligand Asprin, we have found in our database that, being scored 0.10958904, the most similar ligand is CHEMBL1699592. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1699592 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | Cl.CC(C)Cc1ccc(cc1)C(C)CC2=CCC(CN(C)C)C2=O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00010000 01000000 00100102 00110600 00000000 00000000 00000080 00000402 11000900 001808c2 08300000 40019800 0c028000 00200000 00000000 00000000 00004000 02000000 00012010 02000001 00000100 18000290 00008000 00500010 00200000 80200000 00400000 90000000 04000002 80060002 04020000 00430600 |