On Target TAAR1_HUMAN 0.13636364/CHEMBL1429767
For the given ligand Asprin, we have found in our database that, being scored 0.13636364, the most similar ligand is CHEMBL1429767. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1429767 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | OC(=O)\C=C\C(=O)NCCC1=CCCCC1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 09009000 00100000 00000400 00000000 00000000 00180000 20000402 01000000 00100088 00200000 41010000 00028002 00010000 00000400 00080008 20000000 00000160 40212010 00000201 00000000 10040f10 00008000 00100018 00201000 08008800 00484000 90000000 00000000 00040401 04020000 02000200 |