On Target CXCR3_HUMAN 0.12857144/CHEMBL2205704
For the given ligand Asprin, we have found in our database that, being scored 0.12857144, the most similar ligand is CHEMBL2205704. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL2205704 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | [I-].CC1(C)[C@H]2CC=C(C[N+](C)(C)Cc3ccc(I)cc3)[C@@H]1C2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000010 01008000 00100100 00010600 00000000 00000000 00100000 22001402 00000000 001008c0 00200000 40018000 00020942 02010010 00000400 00000100 20000000 02000120 00002100 00000201 00010040 18008010 00018000 00500010 00200000 c0000000 00484200 90000000 00000100 00060000 24260000 00000200 |