On Target ACM1_HUMAN 0.16129032/CHEMBL451821
For the given ligand Asprin, we have found in our database that, being scored 0.16129032, the most similar ligand is CHEMBL451821. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL451821 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CN[C@H](C(C)C)C(=O)N(C)[C@H]1CC[C@]2(C)[C@H]3CC[C@]45CN(C)[C@@H](C)[C@H]4CC[C@H]5[C@@H]3CC=C2C1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 09001000 00100000 04000400 00000000 00000010 00080000 20000402 00000000 00100088 00200000 41013000 04028002 00002000 00000400 00000000 00000000 00000060 42012000 00000201 00000000 30040610 00008001 02100018 00200000 00000000 00404000 90000000 08000000 01040401 24024000 00002200 |