On Target NPBW1_HUMAN 0.044692736/CHEMBL1940536
For the given ligand Asprin, we have found in our database that, being scored 0.044692736, the most similar ligand is CHEMBL1940536. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1940536 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | COc1ccc(cc1)C(C)(C)N[C@@H]2CC[C@@H]([C@H](C2)c3ccsc3)C(=O)N4CCN(CC4)c5oc6ccccc6n5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00010002 01002208 201a090a 85010600 00141200 00008040 02040480 23001608 00084a20 200c08d0 08300204 4001b080 44028c1a 01603001 01001441 0014000c 00000000 42005000 02202488 40a24601 40080000 7e8086b0 24c08821 36780018 00004800 c4000000 00320010 98000004 0800231a 0106080b a0169080 00c10e10 |