On Target CLTR1_HUMAN 0.08035714/CHEMBL285954
For the given ligand Asprin, we have found in our database that, being scored 0.08035714, the most similar ligand is CHEMBL285954. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL285954 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](Sc1ccc(cc1)C(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00010402 01841a00 00020100 00110200 40180000 00004001 00000000 00000402 04208100 00104840 00401220 60029000 04138028 02850000 02010404 0008000c 04800000 02000001 00406080 00220001 80002001 0a120a20 01808100 0060081f 00202010 80000000 00404000 80000010 00000000 40120000 f4820000 05010020 |