On Target ADRB1_HUMAN 0.083333336/CHEMBL1083669
For the given ligand Asprin, we have found in our database that, being scored 0.083333336, the most similar ligand is CHEMBL1083669. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL1083669 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CN1CCC(CC1)NCC(O)COc2ccccc2CC=C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 04000000 01000408 20100108 00010600 00001080 82800000 02000001 00000600 00040010 001809e0 08200000 50018000 00800002 00000000 01280001 00082008 10200000 22108000 00800000 00020201 00000000 18000000 07000080 08500010 00200001 c0000000 00000000 10800000 00000300 00060012 04000000 00002640 |