On Target CXCR1_HUMAN 0.05882353/CHEMBL218964
For the given ligand Asprin, we have found in our database that, being scored 0.05882353, the most similar ligand is CHEMBL218964. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL218964 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | CCC(CC)NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 10404002 01000808 60100102 00012600 20000001 68022000 020000a0 22401500 05a00440 001008d0 00280004 5002b000 0a008802 00200000 80020040 10006048 00050001 22008000 08230210 20020201 48100880 18128600 20000000 00408014 04041000 80000080 20400010 900c0580 20508102 20060001 84045420 40002200 |