On Target DRD5_HUMAN 0.08421053/CHEMBL487387
For the given ligand Asprin, we have found in our database that, being scored 0.08421053, the most similar ligand is CHEMBL487387. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL487387 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | COc1cc2CCN3Cc4c(C[C@H]3c2cc1O)ccc(O)c4OC |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000008 46000008 20100108 10010600 00001020 c0000102 02040000 02001401 00000880 00180840 08300000 40808000 00004882 20200000 01000401 0000a008 00002200 02000020 00080000 00020201 00020100 18308000 00404000 81440010 00000000 c0000001 00324000 80000000 04000300 00860002 24040000 00002700 |