On Target NPY1R_HUMAN 0.0927835/CHEMBL549377
For the given ligand Asprin, we have found in our database that, being scored 0.0927835, the most similar ligand is CHEMBL549377. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL549377 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | COc1ccccc1[C@@H](C)N[C@@H]2CC[C@@H](C(=O)N3CCC(CC3)(C(=O)N4CCCC4)c5ccccc5)C(C)(C)C2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00030000 01001208 20100108 00010600 00001000 00000110 02000000 22001600 00200880 001808c0 08300000 50039000 0500881a 00000000 41000401 00042008 00000000 02000000 02002000 00020201 00000100 18248630 00000000 81500018 00000000 c0000000 00000000 90000000 04000300 0006000b 24062000 00802600 |