On Target OPRD_HUMAN 0.118421055/CHEMBL218242
For the given ligand Asprin, we have found in our database that, being scored 0.118421055, the most similar ligand is CHEMBL218242. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL218242 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | C[C@H]1CN2CCN(Cc3ccccc3O)C[C@H]2C[C@@]1(C)c4cccc(O)c4 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 43000208 20100102 04010600 00000000 40000000 02000000 22001400 00100800 001908c0 08300000 50018000 00000802 00202000 00000400 00042008 00000000 02000000 00002000 00020201 00000100 38008010 00000021 02500010 00000000 c0000000 00000000 90000000 08000100 0006000a 24040000 00002600 |