On Target 5HT2C_HUMAN 0.125/CHEMBL2260568
For the given ligand Asprin, we have found in our database that, being scored 0.125, the most similar ligand is CHEMBL2260568. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL2260568 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | C1CC2CNCCN3[C@@H]4CCC[C@@H]4C(C1)C23 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 00000000 01000400 00100000 04000400 00000000 00000010 00000000 20000000 00000000 000001a0 00200000 40010000 00000002 00002000 00000000 00000000 00000000 00000000 02002000 00000201 08000000 30000010 00000001 02100010 00000000 00000000 00000000 10000000 08000000 01040010 00020000 00002200 |